CAS 18842-99-4: Scandoside

Description:Scandoside, with the CAS number 18842-99-4, is a naturally occurring compound classified as a glycoside. It is primarily derived from various plant sources, particularly from the genus *Scandix*. Scandoside is characterized by its structural composition, which typically includes a sugar moiety linked to a non-sugar aglycone. This compound has garnered interest in the field of pharmacology due to its potential biological activities, including antioxidant and anti-inflammatory properties. Additionally, it may exhibit effects on the central nervous system and has been studied for its potential therapeutic applications. Scandoside is often analyzed using techniques such as chromatography and mass spectrometry to determine its purity and concentration in various extracts. As with many natural products, the specific characteristics, including solubility and stability, can vary depending on the source and extraction methods used. Overall, Scandoside represents a fascinating area of study within natural product chemistry and its implications for health and medicine.

Formula:C₁₆H₂₂O₁₁

InChI:InChI=1S/C16H22O11/c17-2-5-1-7(19)10-6(14(23)24)4-25-15(9(5)10)27-16-13(22)12(21)11(20)8(3-18)26-16/h1,4,7-13,15-22H,2-3H2,(H,23,24)/t7-,8-,9-,10+,11-,12+,13-,15+,16+/m1/s1

InChI key:InChIKey=ZVXWFPTVHBWJOU-AWQYILTISA-N

SMILES:O=C(O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C3C(=CC(O)C13)CO

Synonyms:
Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, [1S-(1α,4aα,5α,7aα)]-
Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, (1S,4aS,5R,7aS)-
Scandoside
(1S,4aS,5R,7aS)-1-(β-D-Glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)cyclopenta[c]pyran-4-carboxylic acid