CAS 188438-05-3

(2E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoic acid

Description:

(2E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]prop-2-enoic acid, with CAS number 188438-05-3, is an organic compound characterized by its unique structure that includes a furan ring and a prop-2-enoic acid moiety. This compound features a double bond in the prop-2-enoic acid part, indicating it is an unsaturated carboxylic acid. The presence of the 3,4-dichlorophenyl group contributes to its potential biological activity and lipophilicity, which may influence its solubility and reactivity. The furan ring adds to the compound's aromatic character, potentially affecting its electronic properties and interactions with biological targets. As a chemical entity, it may exhibit various properties such as acidity, stability under different pH conditions, and reactivity with nucleophiles or electrophiles. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and toxicological assessments. Overall, this compound represents a class of molecules that may have significance in medicinal chemistry and material science.

Formula: C₁₃H₈Cl₂O₃

InChI: InChI=1/C13H8Cl2O3/c14-10-4-1-8(7-11(10)15)12-5-2-9(18-12)3-6-13(16)17/h1-7H,(H,16,17)/b6-3+

Synonyms:

• (2E)-3-[5-(3,4-Dichlorophenyl)-2-furyl]acrylic acid
• 2-Propenoic acid, 3-[5-(3,4-dichlorophenyl)-2-furanyl]-, (2E)-

(E)-3-(5-(3,4-Dichlorophenyl)furan-2-yl)acrylic acid

CAS: 188438-05-3

Formula: C₁₃H₈Cl₂O₃

Color and Shape: Solid

Molecular weight: 283.1068

Ref: IN-DA002GW3

3-[5-(3,4-Dichloro-phenyl)-furan-2-yl]-acrylic acid

CAS: 188438-05-3

Formula: C₁₃H₈Cl₂O₃

Purity: 95.0%

Molecular weight: 283.1

Ref: 10-F027529