CAS 188447-91-8
:(S)-4-Methylbezenesulfinamide
Description:
(S)-4-Methylbenzenesulfinamide, with the CAS number 188447-91-8, is an organic compound characterized by its sulfinamide functional group attached to a methyl-substituted aromatic ring. This compound typically appears as a solid and is known for its chiral nature, which is indicated by the (S) configuration, meaning it has a specific spatial arrangement of its atoms that can influence its reactivity and interactions in biological systems. The presence of the sulfinamide group imparts unique chemical properties, making it useful in various synthetic applications, particularly in the field of medicinal chemistry. It may exhibit specific stereochemical behavior, which can be crucial for its efficacy in biological contexts. Additionally, (S)-4-Methylbenzenesulfinamide can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its practical applications.
Formula:C7H9NOS
InChI:InChI=1/C7H9NOS/c1-6-2-4-7(5-3-6)10(8)9/h2-5H,8H2,1H3/t10-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(S)-(+)-p-Toluenesulfinamide
CAS:Formula:C7H9NOSPurity:>98.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:155.22(S)-4-Methylbenzenesulfinamide, 95% (99% ee)
CAS:(S)-4-Methylbenzenesulfinamide, 95% (99% ee)
Formula:C7H9NOSPurity:95% (99% ee)Color and Shape:white to light yellow pwdr.Molecular weight:155.20Benzenesulfinamide, 4-methyl-, [S(S)]-
CAS:Formula:C7H9NOSPurity:98%Color and Shape:SolidMolecular weight:155.2175(S)-(+)-p-Toluenesulfinamide
CAS:(S)-(+)-p-ToluenesulfinamideFormula:C7H9NOSPurity:99%Color and Shape: off-white to light yellow solidMolecular weight:155.22g/mol(S)-4-Toluenesulfinamide
CAS:Formula:C7H9NOSPurity:97%Color and Shape:Off-white powderMolecular weight:155.22(S)-4-Methylbenzenesulfinamide
CAS:(S)-4-Methylbenzenesulfinamide is a synthetic β-amino acid that has been used for the synthesis of various heterocycles. It has been shown to be a selective inhibitor of the enzyme carboxypeptidase B (CPB) in vitro, which is involved in the degradation of β-amino acids. The stereoselective synthesis of (S)-4-methylbenzenesulfinamide has been achieved through the use of hydrophobic phenylphosphinate as a chiral ligand and an azetidine as a starting material. The reaction time was found to be 20 minutes at room temperature with ethyl phenylphosphinate.Formula:C7H9NOSPurity:Min. 95%Color and Shape:White PowderMolecular weight:155.22 g/mol






