CAS 188490-07-5
:Flufenpyr
Description:
Flufenpyr is a chemical compound classified as a pyridine derivative, primarily known for its application as a pesticide, particularly in agricultural settings. It functions as a selective herbicide, targeting specific weed species while minimizing impact on crops. The molecular structure of flufenpyr features a pyridine ring, which contributes to its biological activity. It is characterized by its relatively low volatility and stability under standard environmental conditions, making it effective for prolonged use in fields. Flufenpyr operates through the inhibition of photosynthesis in target plants, disrupting their growth and development. Its mode of action is primarily linked to the interference with the electron transport chain in chloroplasts. Additionally, flufenpyr is subject to regulatory assessments to ensure safety for human health and the environment, with guidelines established for its application and usage. As with many agrochemicals, proper handling and adherence to safety protocols are essential to mitigate potential risks associated with its use.
Formula:C14H9ClF4N2O4
InChI:InChI=1S/C14H9ClF4N2O4/c1-6-7(14(17,18)19)4-20-21(13(6)24)10-3-11(25-5-12(22)23)8(15)2-9(10)16/h2-4H,5H2,1H3,(H,22,23)
InChI key:InChIKey=WFZSZAXUALBVNX-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OCC(O)=O)=C(Cl)C1)N2C(=O)C(C)=C(C(F)(F)F)C=N2
Synonyms:- 2-[2-Chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl]phenoxy]acetic acid
- Acetic acid, (2-chloro-4-fluoro-5-(5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl)phenoxy)-
- Acetic acid, 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl]phenoxy]-
- Flufenpyr
- Flufenpyr [ISO]
- {2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1(6H)-yl]phenoxy}acetic acid
- 2-[2-Chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
