CAS 1885-32-1
:2-Amino-3-methylbenzamide
Description:
2-Amino-3-methylbenzamide, with the CAS number 1885-32-1, is an organic compound characterized by the presence of an amino group (-NH2) and a methyl group (-CH3) attached to a benzamide structure. This compound features a benzene ring substituted at the 3-position with a methyl group and at the 2-position with an amino group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the amino group, which can engage in hydrogen bonding. The compound may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including acylation and amidation. Additionally, 2-amino-3-methylbenzamide can serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals, making it of interest in medicinal chemistry and material science. Its reactivity and solubility characteristics make it a valuable compound for further research and application in various chemical processes.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H2,10,11)
InChI key:InChIKey=FEBQTMQGJXZYKX-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(N)C(C)=CC=C1
Synonyms:- Benzamide, 2-amino-3-methyl-
- Benzamide, 2-amino-3-methyl- (9CI)
- m-Toluamide, 2-amino-
- 2-Amino-3-methylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzamide, 2-amino-3-methyl-
CAS:Formula:C8H10N2OPurity:97%Color and Shape:SolidMolecular weight:150.17782-Amino-3-methylbenzamide
CAS:2-Amino-3-methylbenzamidePurity:97%Color and Shape:White PowderMolecular weight:150.18g/mol2-Amino-3-methylbenzamide
CAS:Formula:C8H10N2OPurity:97%Color and Shape:Solid, White powderMolecular weight:150.1812-Amino-3-methylbenzamide
CAS:Chlorantraniliprole is a fungicide that inhibits the function of the ryanodine receptor and blocks the release of calcium from intracellular stores. It has been shown to be effective against bacteria such as E. coli, Klebsiella pneumoniae and Salmonella typhimurium in vitro. Chlorantraniliprole was also shown to inhibit bacterial growth in vivo in a mouse model. This drug has demonstrated statistically significant antibacterial activity against gram-positive bacteria such as Staphylococcus aureus, Bacillus subtilis, and Streptococcus pyogenes. Chlorantraniliprole is an amide with a trifluoromethyl group attached to the nitrogen atom on the pyrazole ring. The chlorantraniliprole molecule contains an anthranilic linker between the chlorantranilic acid and 2-amino-3-methylbenzamide rings.Formula:C8H10N2OPurity:Min. 95%Molecular weight:150.18 g/mol



