CymitQuimica logo

CAS 1885094-62-1

:

1-(5-(2-fluorophenyl)-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)-N,N-dimethylmethanamine

Description:
1-(5-(2-fluorophenyl)-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)-N,N-dimethylmethanamine is a complex organic compound characterized by its multi-functional structure, which includes a pyrrole ring, a pyridine moiety, and a sulfonyl group. The presence of a fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as fluorinated compounds often exhibit enhanced biological activity and metabolic stability. The dimethylmethanamine component indicates that the compound may possess basic properties, potentially influencing its solubility and interaction with biological targets. This compound's intricate structure may contribute to its specificity and potency in biological systems, making it a candidate for further investigation in drug discovery. Additionally, the sulfonyl group can enhance the compound's reactivity and solubility in various solvents, which is crucial for its application in synthetic and medicinal chemistry. Overall, the unique combination of functional groups in this compound suggests a diverse range of potential applications, particularly in therapeutic contexts.
Formula:C18H18FN3O2S
InChI:InChI=1S/C18H18FN3O2S/c1-21(2)12-14-10-18(16-7-3-4-8-17(16)19)22(13-14)25(23,24)15-6-5-9-20-11-15/h3-11,13H,12H2,1-2H3
InChI key:YUNMYHHGXTYDOY-UHFFFAOYSA-N
SMILES:CN(C)CC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3
Found 8 products.