CAS 188577-68-6

2-Amino-4,5-dichloropyridine

Description:

2-Amino-4,5-dichloropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two chlorine substituents at the 4 and 5 positions and an amino group at the 2 position, contributing to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The chlorine atoms enhance its electrophilic character, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's structure allows for potential interactions with biological systems, which can be explored for medicinal chemistry applications. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-Amino-4,5-dichloropyridine is a versatile compound with significant implications in chemical research and industry.

Formula: C₅H₄Cl₂N₂

InChI: InChI=1/C5H4Cl2N2/c6-3-1-5(8)9-2-4(3)7/h1-2H,(H2,8,9)

SMILES: c1c(c(c[nH]c1=N)Cl)Cl

Synonyms:

• 2-Pyridinamine,4,5-dichloro-(9CI)
• 2-Amino-4,5-Dichloropyridine 97%
• 4,5-Dichloropyridin-2-Amine

2-Pyridinamine, 4,5-dichloro-

CAS: 188577-68-6

Formula: C₅H₄Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.0047

Ref: IN-DA002H0L

2-Amino-4,5-dichloropyridine

CAS: 188577-68-6

2-Amino-4,5-dichloropyridine

Formula: C₅H₄Cl₂N₂

Purity: 95%

Color and Shape: red brown powder

Molecular weight: 163.00g/mol

Ref: 54-OR59818

2-Amino-4,5-dichloropyridine

CAS: 188577-68-6

Formula: C₅H₄Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163

Ref: 10-F047844