CAS 188586-75-6

2-Amino-2-(3-bromophenyl)ethanol

Description:

2-Amino-2-(3-bromophenyl)ethanol is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a carbon chain that also features a brominated phenyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the bromine atom on the phenyl ring introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. The compound's structure allows for various functional modifications, which can be explored for enhancing its efficacy or selectivity in biological systems. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.

Formula: C₈H₁₀BrNO

InChI: InChI=1S/C8H10BrNO/c9-7-3-1-2-6(4-7)8(10)5-11/h1-4,8,11H,5,10H2

SMILES: c1cc(cc(c1)Br)C(CO)N

Synonyms:

• Benzeneethanol, beta-amino-3-bromo-

Benzeneethanol, β-​amino-​3-​bromo-

CAS: 188586-75-6

Formula: C₈H₁₀BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.0751

Ref: IN-DA002H05

b-Amino-3-bromobenzeneethanol

CAS: 188586-75-6

b-Amino-3-bromobenzeneethanol

Purity: 98%

Molecular weight: 216.08g/mol

Ref: 54-OR452171

2-AMINO-2-(3-BROMOPHENYL)ETHAN-1-OL

CAS: 188586-75-6

Formula: C₈H₁₀BrNO

Purity: 97%

Molecular weight: 216.078

Ref: 10-F514377