CAS 188605-15-4

aspinolide B

Description:

Aspinolide B is a natural product classified as a cyclic peptide, specifically belonging to the class of compounds known as cyclic lipopeptides. It is derived from certain species of fungi and exhibits a range of biological activities, including antimicrobial and antifungal properties. The molecular structure of Aspinolide B features a cyclic arrangement of amino acids, which contributes to its stability and biological function. Its unique structure allows it to interact with various biological targets, making it of interest in pharmaceutical research. The compound has been studied for its potential applications in drug development, particularly in the context of combating resistant strains of pathogens. Additionally, Aspinolide B may exhibit cytotoxic effects against certain cancer cell lines, highlighting its potential as an anticancer agent. As with many natural products, the extraction and synthesis of Aspinolide B can be complex, and ongoing research aims to elucidate its mechanisms of action and optimize its therapeutic potential.

Formula: C₁₄H₂₀O₆

InChI: InChI=1/C14H20O6/c1-3-4-13(17)20-12-7-5-10(15)11(16)6-8-14(18)19-9(12)2/h3-5,7,9-12,15-16H,6,8H2,1-2H3/b4-3+,7-5+/t9-,10-,11+,12+/m1/s1

Synonyms:

• Aspinolide B
• (2R,3S,4E,6R,7S)-6,7-dihydroxy-2-methyl-10-oxo-3,6,7,8,9,10-hexahydro-2H-oxecin-3-yl (2E)-but-2-enoate
• 2-Butenoic acid, (2R,3S,4E,6R,7S)-3,6,7,8,9,10-hexahydro-6,7-dihydroxy-2-methyl-10-oxo-2H-oxecin-3-yl ester, (2E)-

Aspinolide B

CAS: 188605-15-4

Aspinolide B is a pentaketide compound and a decanolide known for its activity in regulating plant growth, which can be extracted from [Aspergillus ochraceus]. Aspinolide B enhances the growth of lateral roots in [S. lycopersicum] and can be utilized in related research studies.

Formula: C₁₄H₂₀O₆

Color and Shape: Solid

Molecular weight: 284.31

Ref: TM-TN8402