CAS 188614-01-9
:Methyl 3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate
Description:
Methyl 3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazine moiety. This compound typically exhibits a range of functional groups, including a carbonyl group and an ester, contributing to its reactivity and potential applications in organic synthesis. The presence of the benzothiazine ring suggests potential biological activity, as many compounds containing this structure are known for their pharmacological properties. Methyl 3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate may be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. The compound's molecular interactions and potential applications in medicinal chemistry or as a synthetic intermediate make it of interest in various research fields. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C10H9NO3S
InChI:InChI=1/C10H9NO3S/c1-14-10(13)6-2-3-8-7(4-6)11-9(12)5-15-8/h2-4H,5H2,1H3,(H,11,12)
SMILES:COC(=O)c1ccc2c(c1)N=C(CS2)O
Synonyms:- Methyl-3-Oxo-3,4-Dihydro-2H-1,
- Methyl 3,4-dihydro-3-oxo-2H-benzo[b][1,4]thiazine-6-carboxylate
- Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-6-carboxylate
- methyl 3-oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-6-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H9NO3SPurity:97%Molecular weight:223.25Methyl 3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate
CAS:Formula:C10H9NO3SPurity:95%Color and Shape:SolidMolecular weight:223.2484Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-6-carboxylate
CAS:Methyl 3,4-dihydro-3-oxo-2H-1,4-benzothiazine-6-carboxylatePurity:≥95%Color and Shape:PowderMolecular weight:223.25g/molMethyl 3-Oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylate
CAS:Formula:C10H9NO3SPurity:97%Color and Shape:SolidMolecular weight:223.25



