CAS 188640-63-3

L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1)

Description:

L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes an ethynyl group attached to the phenylalanine amino acid. This compound is a hydrochloride salt, indicating that it is a stable form suitable for various applications, particularly in biochemical and pharmaceutical contexts. L-Phenylalanine itself is an essential amino acid, playing a crucial role in protein synthesis and serving as a precursor for neurotransmitters such as dopamine, norepinephrine, and epinephrine. The ethynyl substitution can influence the compound's solubility, reactivity, and biological activity. Typically, compounds like this may exhibit properties such as being hygroscopic and having specific melting points, which can vary based on purity and environmental conditions. Additionally, the hydrochloride form enhances its stability and solubility in aqueous solutions, making it useful in research and potential therapeutic applications. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₁H₁₁NO₂·ClH

InChI: InChI=1S/C11H11NO2.ClH/c1-2-8-3-5-9(6-4-8)7-10(12)11(13)14;/h1,3-6,10H,7,12H2,(H,13,14);1H/t10-;/m0./s1

InChI key: InChIKey=MLHYNRVXXMXXQM-PPHPATTJSA-N

SMILES: C([C@@H](C(O)=O)N)C1=CC=C(C#C)C=C1.Cl

Synonyms:

• L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1)
• 4-Ethynyl-L-phenylalanine hydrochloride
• L-Phenylalanine, 4-ethynyl-, hydrochloride

p-Ethynylphenylalanine hydrochloride

CAS: 188640-63-3

p-Ethynylphenylalanine hydrochloride (4-Ethynyl-L-phenylalanine HCL) is a novel, potent and specific inhibitor of TPH[1].

Formula: C₁₁H₁₂ClNO₂

Purity: 99.03%

Color and Shape: Solid

Molecular weight: 225.67

Ref: TM-T10142L

p-Ethynylphenylalanine hydrochloride

CAS: 188640-63-3

p-Ethynylphenylalanine hydrochloride

Purity: ≥98%

Molecular weight: 225.67g/mol

Ref: 54-BUP06846