CAS 188640-63-3: L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1)

Description:L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes an ethynyl group attached to the phenylalanine amino acid. This compound is a hydrochloride salt, indicating that it is a stable form suitable for various applications, particularly in biochemical and pharmaceutical contexts. L-Phenylalanine itself is an essential amino acid, playing a crucial role in protein synthesis and serving as a precursor for neurotransmitters such as dopamine, norepinephrine, and epinephrine. The ethynyl substitution can influence the compound's solubility, reactivity, and biological activity. Typically, compounds like this may exhibit properties such as being hygroscopic and having specific melting points, which can vary based on purity and environmental conditions. Additionally, the hydrochloride form enhances its stability and solubility in aqueous solutions, making it useful in research and potential therapeutic applications. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula:C₁₁H₁₁NO₂·ClH

InChI:InChI=1S/C11H11NO2.ClH/c1-2-8-3-5-9(6-4-8)7-10(12)11(13)14;/h1,3-6,10H,7,12H2,(H,13,14);1H/t10-;/m0./s1

InChI key:InChIKey=MLHYNRVXXMXXQM-PPHPATTJSA-N

SMILES:Cl.O=C(O)C(N)CC1=CC=C(C#C)C=C1

Synonyms:
L-Phenylalanine, 4-ethynyl-, hydrochloride (1:1)
4-Ethynyl-L-phenylalanine hydrochloride
L-Phenylalanine, 4-ethynyl-, hydrochloride

Found 3 products.

Product data	Purity	Price range	Estimated delivery
p-Ethynylphenylalanine hydrochloride REF: TM-T10142LCAS: 188640-63-3	99.03%	35.00 €~78.00 €	Thu 17 Apr 25
p-Ethynylphenylalanine hydrochloride REF: 54-BUP06846CAS: 188640-63-3	99.02%	77.00 €~105.00 €	Mon 21 Apr 25
4-Ethynyl-L-phenylalanine hydrochloride REF: 3D-NHA64063CAS: 188640-63-3	Min. 95%	- - -	Discontinued product