CAS 188666-34-4
:N-Acetyl-4,6-(p-methoxybenzylidene)-2-deoxy-1-O-methyl- a-D-galactosamine
Description:
N-Acetyl-4,6-(p-methoxybenzylidene)-2-deoxy-1-O-methyl-α-D-galactosamine is a synthetic compound that belongs to the class of glycosides, specifically modified amino sugars. This compound features a galactosamine backbone, which is a derivative of galactose, with an N-acetyl group that enhances its solubility and biological activity. The presence of the p-methoxybenzylidene moiety indicates that it has been functionalized to potentially improve its pharmacological properties, such as increased stability or specificity in biological interactions. The methoxy group contributes to its lipophilicity, which can influence its membrane permeability. This compound may exhibit interesting biological activities, including potential applications in medicinal chemistry, particularly in the development of glycosylated drugs or as a probe in glycan-related studies. Its unique structure suggests that it could interact with various biological targets, making it a subject of interest in research focused on carbohydrate chemistry and its applications in drug design.
Formula:C17H23NO7
InChI:InChI=1/C17H23NO7/c1-9(19)18-13-14(20)15-12(24-17(13)22-3)8-23-16(25-15)10-4-6-11(21-2)7-5-10/h4-7,12-17,20H,8H2,1-3H3,(H,18,19)/t12?,13-,14+,15-,16?,17-/m0/s1
Synonyms:- Methyl 2-(Acetylamino)-2-deoxy-4,6-O-[(4-methoxyphenyl)methylene]-a-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Galactopyranoside, methyl 2-(acetylamino)-2-deoxy-4,6-O-[(4-methoxyphenyl)methylene]-
CAS:Formula:C17H23NO7Color and Shape:SolidMolecular weight:353.367N-Acetyl-4,6-(p-methoxybenzylidene)-2-deoxy-1-O-methyl-α-D-galactosamine
CAS:N-Acetyl-4,6-(p-methoxybenzylidene)-2-deoxy-1-O-methyl-a-D-galactosamine is a custom synthesis of a monosaccharide. It has been modified with fluorination and methylation. The structure is an oligosaccharide, polysaccharide, saccharide or sugar that can be used as a carbohydrate. CAS No. 188666-34-4Formula:C17H23NO7Purity:Min. 95%Molecular weight:353.37 g/mol



