CymitQuimica logo

CAS 188674-89-7

:

3-[Bis(methylthio)methylene]bicyclo[2.2.1]heptan-2-one

Description:
3-[Bis(methylthio)methylene]bicyclo[2.2.1]heptan-2-one, with the CAS number 188674-89-7, is a bicyclic organic compound characterized by its unique structural features. It contains a bicyclo[2.2.1]heptane framework, which is a saturated hydrocarbon structure consisting of two fused cyclopropane rings. The compound is further modified by the presence of a ketone functional group at the 2-position and two methylthio groups attached to a methylene bridge, contributing to its reactivity and potential applications in organic synthesis. The presence of sulfur in the methylthio groups can impart distinctive properties, such as increased nucleophilicity and potential for further chemical transformations. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H14OS2
InChI:InChI=1S/C10H14OS2/c1-12-10(13-2)8-6-3-4-7(5-6)9(8)11/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=CCDGWCRNTPBXAM-UHFFFAOYSA-N
SMILES:C(SC)(SC)=C1C2CC(C1=O)CC2
Synonyms:
  • Bicyclo[2.2.1]heptan-2-one, 3-[bis(methylthio)methylene]-
  • 2-[Bis(methylsulfanyl)methylidene]bicyclo[2.2.1]heptan-3-one
  • 3-[Bis(methylthio)methylene]bicyclo[2.2.1]heptan-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.