CymitQuimica logo

CAS 188677-49-8

:

3-Iodo-4-pyridinecarboxylic acid methyl ester

Description:
3-Iodo-4-pyridinecarboxylic acid methyl ester is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the iodo substituent at the 3-position and the methyl ester functional group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its polar and non-polar characteristics due to the ester and aromatic functionalities. It may exhibit moderate to high reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the iodo group. Additionally, the compound can participate in various chemical transformations, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions with biological targets, which may be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C7H6INO2
InChI:InChI=1/C7H6INO2/c1-11-7(10)5-2-3-9-4-6(5)8/h2-4H,1H3
InChI key:XZUYSNLMTTZFDY-UHFFFAOYSA-N
SMILES:COC(=O)c1ccncc1I
Synonyms:
  • Methyl 3-Iodopyridine-4-Carboxylate
  • 3-Iodoisonicotinic Acid Methyl Ester
Found 4 products.