CAS 188690-82-6
:(R)-1-(4-Benzyloxy-3-nitrophenyl)-2-bromoethanol
Description:
(R)-1-(4-Benzyloxy-3-nitrophenyl)-2-bromoethanol is a chiral organic compound characterized by its specific stereochemistry and functional groups. The presence of a bromine atom indicates it is a bromoalcohol, which can participate in nucleophilic substitution reactions. The compound features a benzyloxy group, which enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The nitro group on the aromatic ring contributes to the compound's electron-withdrawing properties, potentially affecting its reactivity in electrophilic aromatic substitution reactions. The chirality of the molecule suggests that it may exhibit different biological activities depending on its enantiomeric form. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C15H14BrNO4
InChI:InChI=1/C15H14BrNO4/c16-9-14(18)12-6-7-15(13(8-12)17(19)20)21-10-11-4-2-1-3-5-11/h1-8,14,18H,9-10H2/t14-/m0/s1
SMILES:c1ccc(cc1)COc1ccc(cc1N(=O)=O)[C@H](CBr)O
Synonyms:- (R)-2-Bromo-1-(3-nitro-4-benzyloxyphenyl)ethanol
- (1R)-1-[4-(benzyloxy)-3-nitrophenyl]-2-bromoethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
