
CAS 1886967-47-0
:Bicyclo[1.1.1]pentan-1-amine, 3-(difluoromethyl)-
Description:
Bicyclo[1.1.1]pentan-1-amine, 3-(difluoromethyl)- is a chemical compound characterized by its bicyclic structure, which consists of a central bicyclo[1.1.1]pentane framework with an amine functional group and a difluoromethyl substituent. The bicyclo[1.1.1]pentane moiety contributes to its unique three-dimensional shape, which can influence its reactivity and interactions with biological targets. The presence of the amine group indicates potential basicity and the ability to form hydrogen bonds, while the difluoromethyl group introduces significant electronegativity and steric effects, which can affect the compound's lipophilicity and overall stability. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can modulate biological activity. Additionally, the presence of fluorine atoms often enhances metabolic stability and bioavailability. Overall, Bicyclo[1.1.1]pentan-1-amine, 3-(difluoromethyl)- is a compound of interest for further research in various chemical and biological applications.
Formula:C6H9F2N
InChI:InChI=1S/C6H9F2N/c7-4(8)5-1-6(9,2-5)3-5/h4H,1-3,9H2
InChI key:InChIKey=UFLXSCDWEMZHRH-UHFFFAOYSA-N
SMILES:C(F)(F)C12CC(N)(C1)C2
Synonyms:- 3-(Difluoromethyl)bicyclo[1.1.1]pentan-1-amine
- Bicyclo[1.1.1]pentan-1-amine, 3-(difluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.