CymitQuimica logo

CAS 188774-55-2

:

5-Bromo-2-chlorobenzamide

Description:
5-Bromo-2-chlorobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and chlorine atoms, as well as an amide functional group. The presence of the bromine and chlorine substituents typically influences its reactivity and solubility properties, making it a useful intermediate in organic synthesis. This compound is often utilized in pharmaceutical research and development due to its potential biological activity. It may exhibit properties such as antimicrobial or antitumor activity, depending on its specific interactions with biological targets. The molecular structure contributes to its stability and reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's physical properties, such as melting point and solubility, can vary based on the solvent used and the conditions under which it is handled. Safety precautions should be observed when working with this compound, as halogenated compounds can pose health risks.
Formula:C7H5BrClNO
InChI:InChI=1/C7H5BrClNO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H2,10,11)
InChI key:InChIKey=UZELTISECDSPNW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(Cl)C=CC(Br)=C1
Synonyms:
  • Benzamide, 5-Bromo-2-Chloro-
  • 5-Bromo-2-chlorobenzamide
Found 4 products.