CAS 188813-02-7

3-BROMO-5-FLUOROBENZALDEHYDE

Description:

3-Bromo-5-fluorobenzaldehyde is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzaldehyde structure. It features a bromine atom at the meta position (3) and a fluorine atom at the para position (5) relative to the aldehyde functional group. This compound is typically a pale yellow to light brown solid at room temperature and is known for its reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions such as nucleophilic addition and condensation. The bromine and fluorine substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity and making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting physical properties, such as solubility in organic solvents, and could be analyzed using techniques like NMR and mass spectrometry for structural elucidation. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.

Formula: C₇H₄BrFO

InChI: InChI=1/C7H4BrFO/c8-6-1-5(4-10)2-7(9)3-6/h1-4H

SMILES: c1c(cc(cc1Br)F)C=O

Synonyms:

• 3-Bromo-5-fluorobenzaldehyde 98%
• 3-Fluoro-5-Bromobenzaldehyde
• 3-Bromo-5-fluorobenzaldehyde98%
• Pentafluorophenyl Pyridine-2-Carboxylate

Benzaldehyde, 3-bromo-5-fluoro-

CAS: 188813-02-7

Formula: C₇H₄BrFO

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.0085

Ref: IN-DA002HCI

3-Bromo-5-fluorobenzaldehyde

CAS: 188813-02-7

3-Bromo-5-fluorobenzaldehyde

Formula: C₇H₄BrFO

Purity: 98%

Color and Shape: off white to yellow crystalline solid

Molecular weight: 203.01g/mol

Ref: 54-PC2392

3-Bromo-5-fluorobenzaldehyde

CAS: 188813-02-7

Formula: C₇H₄BrFO

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.01

Ref: 10-F013207