CAS 18889-09-3
:Diallylformamide
Description:
Diallylformamide is an organic compound characterized by its structure, which features two allyl groups attached to a formamide functional group. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its reactivity, particularly in polymer chemistry, where it can participate in various polymerization reactions due to the presence of the allyl groups. Diallylformamide is soluble in organic solvents, making it useful in various applications, including as a monomer in the synthesis of resins and as an intermediate in organic synthesis. Its chemical properties include the ability to undergo nucleophilic substitution and addition reactions, which are common in compounds containing both amide and allyl functionalities. Safety considerations should be taken into account when handling this substance, as it may pose health risks if inhaled or absorbed through the skin. Overall, diallylformamide is a versatile compound with applications in materials science and organic synthesis.
Formula:C7H11NO
InChI:InChI=1/C7H11NO/c1-3-5-8(7-9)6-4-2/h3-4,7H,1-2,5-6H2
SMILES:C=CCN(CC=C)C=O
Synonyms:- N,N-Diallylformamide
- N,N-diprop-2-en-1-ylformamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.