CymitQuimica logo

CAS 188890-78-0

:

2-Amino-n,3-dimethylbutanamide hydrochloride

Description:
2-Amino-n,3-dimethylbutanamide hydrochloride is a chemical compound characterized by its amide functional group, which is indicative of its potential as a building block in organic synthesis and pharmaceutical applications. It features a branched alkyl chain, specifically a dimethyl-substituted butanamide structure, which contributes to its unique steric and electronic properties. The presence of the amino group enhances its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often exhibiting improved solubility in aqueous solutions. This compound may be utilized in various research contexts, including studies on enzyme inhibition or as a precursor in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C6H14N2O·HCL
InChI:InChI=1S/C6H14N2O.ClH/c1-4(2)5(7)6(9)8-3;/h4-5H,7H2,1-3H3,(H,8,9);1H
InChI key:PPEBJEOKRFEESV-UHFFFAOYSA-N
SMILES:CC(C)C(C(=O)NC)N.Cl
Found 4 products.