CymitQuimica logo

CAS 188928-11-2

:

4-[(3,4-Dichlorophenyl)methoxy]benzeneethanol

Description:
4-[(3,4-Dichlorophenyl)methoxy]benzeneethanol, identified by its CAS number 188928-11-2, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a methoxy group and a dichlorophenyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of the dichlorophenyl group suggests that it may possess significant biological activity, potentially influencing its interactions in biological systems. The hydroxyl group in the benzeneethanol structure can participate in hydrogen bonding, which may enhance its solubility in polar solvents. Additionally, the compound may exhibit moderate lipophilicity due to the aromatic components, affecting its pharmacokinetic properties if considered for pharmaceutical applications. Overall, the characteristics of this compound make it of interest in both synthetic organic chemistry and medicinal chemistry, where its unique structure could lead to various applications or further derivatization.
Formula:C15H14Cl2O2
InChI:InChI=1S/C15H14Cl2O2/c16-14-6-3-12(9-15(14)17)10-19-13-4-1-11(2-5-13)7-8-18/h1-6,9,18H,7-8,10H2
InChI key:InChIKey=ODXXRJUWIQJJJX-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(CCO)C=C1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:
  • 4-[(3,4-Dichlorophenyl)methoxy]benzeneethanol
  • 2-[4-[(3,4-Dichlorophenyl)methoxy]phenyl]ethanol
  • 2-[4-(3,4-Dichlorobenzyloxy)phenyl]ethyl alcohol
  • Benzeneethanol, 4-[(3,4-dichlorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.