CAS 18895-10-8

4-BROMO-3-CYANOTHIOPHENE

Description:

4-Bromo-3-cyanothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a cyano group at the 3-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It is known for its potential applications in organic electronics, particularly in the development of semiconductors and photovoltaic materials, due to its electronic properties. The cyano group enhances its electron-withdrawing characteristics, making it useful in various chemical reactions, including nucleophilic substitutions and polymerizations. Additionally, the bromine substituent can serve as a site for further functionalization, allowing for the synthesis of more complex molecules. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts. Overall, 4-bromo-3-cyanothiophene is a versatile compound with significant relevance in materials science and organic synthesis.

Formula: C₅H₂BrNS

InChI: InChI=1/C5H2BrNS/c6-5-3-8-2-4(5)1-7/h2-3H

SMILES: C(#N)c1cscc1Br

Synonyms:

• 4-Bromothiophene-3-Carbonitrile
• 3-Bromo-4-cyanothiophene
• 3-Bromothiophene-4-carbonitrile

3-Thiophenecarbonitrile, 4-bromo-

CAS: 18895-10-8

Formula: C₅H₂BrNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0451

Ref: IN-DA002HLD

4-Bromothiophene-3-carbonitrile

CAS: 18895-10-8

4-Bromothiophene-3-carbonitrile

Formula: C₅H₂BrNS

Purity: 99%

Color and Shape: beige solid

Molecular weight: 188.05g/mol

Ref: 54-OR3248

4-Bromothiophene-3-carbonitrile

CAS: 18895-10-8

Formula: C₅H₂BrNS

Purity: 97%

Molecular weight: 188.04

Ref: 10-F242127

4-Bromothiophene-3-carbonitrile

CAS: 18895-10-8

4-Bromothiophene-3-carbonitrile is a reactive, heterocyclic compound that can be prepared by reacting ethyl bromide with 3-carbonitrile in the presence of triethyl orthoformate. This compound can be used as an acceptor for electron and has an optical spectrum that contains a strong absorption at 295 nm, which corresponds to its electron affinity. The compound is also resistant to halogenation and has three functional groups. 4-Bromothiophene-3-carbonitrile can react with various types of halides or other organic compounds to form addition products.

Formula: C₅H₂BrNS

Purity: Min. 95%

Molecular weight: 188.05 g/mol

Ref: 3D-TAA89510