CAS 1890-28-4
:Vinyl ketone
Description:
Vinyl ketone, also known as 3-buten-2-one, is an organic compound characterized by its unsaturated ketone functional group. It features a vinyl group (–CH=CH2) directly attached to a carbonyl group (C=O), making it a member of the α,β-unsaturated carbonyl compounds. This compound is typically a colorless liquid with a pungent odor and is known for its reactivity, particularly in polymerization and addition reactions. Vinyl ketone can undergo various chemical transformations, including Michael addition and Diels-Alder reactions, due to the presence of both the double bond and the carbonyl group. It is used in the synthesis of various polymers and as an intermediate in organic synthesis. Additionally, vinyl ketone is recognized for its potential applications in the production of specialty chemicals and materials. However, it should be handled with care due to its reactivity and potential health hazards associated with exposure.
Formula:C5H6O
InChI:InChI=1S/C5H6O/c1-3-5(6)4-2/h3-4H,1-2H2
InChI key:InChIKey=UCUUFSAXZMGPGH-UHFFFAOYSA-N
SMILES:C(C=C)(C=C)=O
Synonyms:- Divinyl ketone
- Vinyl ketone
- 3-Pentadienone
- 1,4-Pentadien-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Divinyl ketone
CAS:Divinyl ketone is a kind of high reactivity, easy polymerization of multifunctional cyclization reagent.Formula:C5H6OColor and Shape:SolidMolecular weight:82.1
