CAS 1890-99-9: 2′-Hydroxyformononetin
Description:2′-Hydroxyformononetin, with the CAS number 1890-99-9, is a naturally occurring flavonoid belonging to the class of isoflavones. It is primarily found in various plants, particularly in legumes and certain medicinal herbs. This compound is characterized by its phenolic structure, which contributes to its antioxidant properties. 2′-Hydroxyformononetin exhibits potential biological activities, including anti-inflammatory, anti-cancer, and estrogenic effects, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and may have limited solubility in water. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is crucial for its biological activity. Additionally, 2′-Hydroxyformononetin can undergo various chemical reactions, such as methylation and glycosylation, which can modify its properties and enhance its bioactivity. Overall, this compound is significant in the study of natural products and their potential therapeutic applications.
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-8,17-18H,1H3
InChI key:InChIKey=XKHHKXCBFHUOHM-UHFFFAOYSA-N
SMILES:O=C1C(=COC2=CC(O)=CC=C12)C=3C=CC(OC)=CC3O
- Synonyms:
- 2′,7-Dihydroxy-4′-methoxyisoflavone
- 4H-1-Benzopyran-4-one, 7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-
- 7,2′-Dihydroxy-4′-methoxyisoflavone
- 7-Hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one
- 7-Hydroxy-3-(2-hydroxy-4-methoxyphenyl)chromen-4-one
- 7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-chromen-4-one
- Isoflavone, 2′,7-dihydroxy-4′-methoxy-
- S-006-1714
- Xenognosin B
- Zenognosin B
- See more synonyms
- 2′-Hydroxyformononetin
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Astragalus Metabolite 4 REF: 4Z-A-317004CAS: 1890-99-9 | - - - | To inquire | Thu 24 Apr 25 |
![]() | 2'-Hydroxyformononetin REF: 3D-FH137806CAS: 1890-99-9 | Min. 95% | 270.00 €~302.00 € | Mon 28 Apr 25 |

Ref: 4Z-A-317004
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

2'-Hydroxyformononetin
Ref: 3D-FH137806
500µg | 270.00 € |