CAS 189000-38-2

1,4-Benzenediamine, N,N'-bis[4-[(4-aminophenyl)amino]phenyl]-

Description:

1,4-Benzenediamine, N,N'-bis[4-[(4-aminophenyl)amino]phenyl]- is a complex organic compound characterized by its structure, which includes multiple amine functional groups and aromatic rings. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. It is known for its potential applications in the fields of dyes, pigments, and as a precursor in the synthesis of various organic materials. The presence of multiple amino groups suggests that it can participate in various chemical reactions, including coupling reactions, making it useful in polymer chemistry and materials science. Additionally, due to its amine content, it may exhibit basic properties and can form salts with acids. Safety considerations are important when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper safety protocols should be followed to mitigate exposure.

Formula: C₃₀H₂₈N₆

InChI: InChI=1S/C30H28N6/c31-21-1-5-23(6-2-21)33-25-9-13-27(14-10-25)35-29-17-19-30(20-18-29)36-28-15-11-26(12-16-28)34-24-7-3-22(32)4-8-24/h1-20,33-36H,31-32H2

InChI key: JYQXKZCYYZENQY-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1N)NC2=CC=C(C=C2)NC3=CC=C(C=C3)NC4=CC=C(C=C4)NC5=CC=C(C=C5)N

1,4-Benzenediamine, N1,N4-bis[4-[(4-aminophenyl)amino]phenyl]-

CAS: 189000-38-2

Formula: C₃₀H₂₈N₆

Molecular weight: 472.5835

Ref: IN-DA002HO6