CAS 18903-04-3
:1-(1-Piperazinyl)-1-butanone
Description:
1-(1-Piperazinyl)-1-butanone, identified by its CAS number 18903-04-3, is a chemical compound characterized by the presence of a piperazine ring attached to a butanone moiety. This compound typically exhibits properties associated with both amines and ketones, which may influence its reactivity and interactions. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The piperazine group contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities, including anxiolytic and antidepressant effects. The compound's structure allows for hydrogen bonding, which can enhance solubility in polar solvents. Additionally, it may participate in nucleophilic reactions due to the presence of the piperazine nitrogen atoms. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, 1-(1-Piperazinyl)-1-butanone is of interest in both synthetic organic chemistry and pharmaceutical research.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-2-3-8(11)10-6-4-9-5-7-10/h9H,2-7H2,1H3
InChI key:InChIKey=OGQQJMSDOICEAR-UHFFFAOYSA-N
SMILES:C(CCC)(=O)N1CCNCC1
Synonyms:- 1-(1-Oxobutyl)piperazine
- 1-(1-Piperazinyl)-1-butanone
- 1-Butanone, 1-(1-piperazinyl)-
- 1-Butanoylpiperazine
- 1-Butyrylpiperazine
- 1-n-Butyrylpiperazine
- Piperazine, 1-(1-oxobutyl)-
- Piperazine, 1-butyryl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Butanone, 1-(1-piperazinyl)-
CAS:Formula:C8H16N2OPurity:95%Color and Shape:LiquidMolecular weight:156.22541-(Piperazin-1-yl)butan-1-one
CAS:1-(Piperazin-1-yl)butan-1-onePurity:95%Molecular weight:156.23g/mol1-(piperazin-1-yl)butan-1-one
CAS:1-(Piperazin-1-yl)butan-1-one is a neoplastic cell growth inhibitor that inhibits the proliferation of myeloid, k562 and HL60 cells. It has been shown to inhibit the growth of tumor cells in vitro. 1-(Piperazin-1-yl)butan-1-one is an analog of piperazine, which is known to be a cytotoxic agent with anticancer activity. The mechanism of action is not known, but it may be due to its ability to inhibit DNA synthesis or its inhibition of protein synthesis.Formula:C8H16N2OPurity:Min. 95%Molecular weight:156.23 g/mol



