CAS 18903-18-9

5-Aminothiazole-4-carboxylic acid ethyl ester

Description:

5-Aminothiazole-4-carboxylic acid ethyl ester, with the CAS number 18903-18-9, is an organic compound characterized by its thiazole ring structure, which incorporates both amino and carboxylic acid functional groups. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the amino group contributes to its basicity, while the carboxylic acid moiety can participate in various chemical reactions, such as esterification and amidation. The ethyl ester group enhances its lipophilicity, making it more amenable to biological activity. This compound is of interest in pharmaceutical research due to its potential applications in drug development, particularly in the synthesis of biologically active molecules. Its reactivity and functional groups allow for further derivatization, which can lead to the discovery of new therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₆H₈N₂O₂S

InChI: InChI=1/C6H8N2O2S/c1-2-10-6(9)4-5(7)11-3-8-4/h3H,2,7H2,1H3

SMILES: CCOC(=O)c1c(N)scn1

Synonyms:

• Ethyl 5-Amino-1,3-Thiazole-4-Carboxylate

4-Thiazolecarboxylic acid, 5-amino-, ethyl ester

CAS: 18903-18-9

Formula: C₆H₈N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.2049

Ref: IN-DA002HQO

Ethyl 5-amino-1,3-thiazole-4-carboxylate

CAS: 18903-18-9

Ethyl 5-amino-1,3-thiazole-4-carboxylate

Purity: 97%

Molecular weight: 172.20g/mol

Ref: 54-OR51950

Ethyl 5-aminothiazole-4-carboxylate

CAS: 18903-18-9

Formula: C₆H₈N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.2

Ref: 10-F229136