CAS 18904-54-6
:hirsuteine
Description:
Hirsuteine, with the CAS number 18904-54-6, is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the genus *Hippobroma*. This compound is characterized by its complex molecular structure, which includes a bicyclic framework. Hirsuteine exhibits a range of biological activities, including potential anti-inflammatory and analgesic properties, making it of interest in pharmacological research. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. The compound's interactions with biological systems are an area of ongoing study, particularly regarding its mechanism of action and potential therapeutic applications. As with many alkaloids, hirsuteine may also exhibit toxicity at certain concentrations, necessitating careful evaluation in any medicinal context. Overall, hirsuteine represents a fascinating subject for further investigation in both natural product chemistry and drug development.
Formula:C22H26N2O3
InChI:InChI=1/C22H26N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h4-8,13-14,17,20,23H,1,9-12H2,2-3H3/b18-13-/t14-,17-,20-/m0/s1
InChI key:InChIKey=TZUGIFAYWNNSAO-XPOGPMDLSA-N
SMILES:C(\C(OC)=O)(=C/OC)/[C@H]1C[C@]2(C3=C(C=4C(N3)=CC=CC4)CCN2C[C@@H]1C=C)[H]
Synonyms:- 17,18-Secoyohimban-16-carboxylic acid, 16,17,18,19-tetradehydro-17-methoxy-, methyl ester, (E)-
- Brn 0096586
- Corynan-16-carboxylic acid, 16,17,18,19-tetradehydro-17-methoxy-, methyl ester, (16E)-
- Corynantheine
- Indolo[2,3-a]quinolizine-2-acetic acid, 3-ethenyl-1,2,3,4,6,7,12,12b-octahydro-α-(methoxymethylene)-, methyl ester, (αE,2S,3R,12bS)-
- methyl (16Z)-16-(methoxymethylidene)coryn-18-en-17-oate
- Hirsuteine
- 4-25-00-01255 (Beilstein Handbook Reference)
- 5986-06-1 (Hydrochloride)
- Indolo[2,3-a]quinolizine-2-aceticacid, 3-ethenyl-1,2,3,4,6,7,12,12b-octahydro-a-(methoxymethylene)-, methyl ester, (aE,2S,3R,12bS)-
- (16E)-16,17,18,19-Tetradehydro-17-methoxycorynan-16-carboxylic acid methyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Corynantheine
CAS:Controlled ProductFormula:C22H26N2O3Color and Shape:NeatMolecular weight:366.453Corynantheine
CAS:Corynantheine is an indole alkaloid, which is a naturally occurring chemical compound. It is sourced primarily from the Mitragyna genus of trees, specifically Mitragyna speciosa, also known as kratom. The mode of action of corynantheine involves blocking adrenergic receptors, particularly the alpha receptors, which are part of the sympathetic nervous system. This blockade can result in various physiological effects, including vasodilation and reduced blood pressure.Formula:C22H26N2O3Purity:Min. 95%Molecular weight:366.50 g/mol

