CAS 18905-29-8
:6H-Purin-6-one, 2-amino-1,9-dihydro-, 3-oxide
Description:
The chemical substance known as "6H-Purin-6-one, 2-amino-1,9-dihydro-, 3-oxide," with the CAS number 18905-29-8, is a purine derivative characterized by its bicyclic structure, which includes a fused imidazole and pyrimidine ring. This compound features a 2-amino group and a 3-oxide functional group, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in various biochemical applications. The presence of the amino group suggests potential interactions with biological macromolecules, making it of interest in pharmacology and biochemistry. Additionally, its structural features may influence its role in nucleic acid metabolism or as a precursor in the synthesis of other biologically relevant compounds. As with many purine derivatives, it may exhibit properties such as antioxidant activity or serve as a substrate for enzymatic reactions. Overall, this compound's unique structural characteristics position it as a significant entity in the study of nucleobases and related biochemical pathways.
Formula:C5H5N5O2
InChI:InChI=1S/C5H5N5O2/c6-5-9-4(11)2-3(10(5)12)8-1-7-2/h1H,(H,7,8)(H3,6,9,11)
InChI key:InChIKey=NHFYUOGLANHPMJ-UHFFFAOYSA-N
SMILES:O=N=1C2=C(C(=O)NC1N)NC=N2
Synonyms:- Guanine 3-N-oxide
- NSC 145425
- 6H-Purin-6-one, 2-amino-1,9-dihydro-, 3-oxide
- 6H-Purin-6-one, 2-amino-1,7-dihydro-, 3-oxide
- Guanine, 3-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Ref: 3W-CS-O-61354
1g3,750.00€
