CAS 189060-31-9: 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-[(1S)-2-hydroxy-1-methylethyl]-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, sodium salt (1:1), (3R,5S,6E)-
Description:6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-[(1S)-2-hydroxy-1-methylethyl]-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, sodium salt (1:1), (3R,5S,6E)- is a complex organic compound characterized by its multi-functional groups and specific stereochemistry. This compound features a heptenoic acid backbone, which includes a double bond, indicating its unsaturation. The presence of multiple hydroxyl (-OH) groups suggests it has significant polar characteristics, enhancing its solubility in water and potential reactivity. The fluorophenyl group introduces a fluorine atom, which can influence the compound's electronic properties and biological activity. The pyridine ring contributes to the compound's aromaticity and may play a role in its interaction with biological targets. As a sodium salt, it is likely to be more soluble in aqueous environments, making it suitable for various applications in pharmaceuticals or biochemistry. Overall, this compound's unique structure and functional groups suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C26H34FNO6·Na
InChI:InChI=1S/C26H34FNO6.Na/c1-15(2)25-21(10-9-19(30)11-20(31)12-23(32)33)24(17-5-7-18(27)8-6-17)22(14-34-4)26(28-25)16(3)13-29;/h5-10,15-16,19-20,29-31H,11-14H2,1-4H3,(H,32,33);/b10-9+;/t16-,19-,20-;/m1./s1
InChI key:InChIKey=TUYBKPRGKCUDGR-ZZDRRHRHSA-N
SMILES:[Na].O=C(O)CC(O)CC(O)C=CC1=C(N=C(C(=C1C=2C=CC(F)=CC2)COC)C(C)CO)C(C)C
- Synonyms:
- (3R,5S,6E)- 7-[4-(4-Fluorophenyl)-6-[(1S)-2-hydroxy-1-methylethyl]-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-6-heptenoic Acid Sodium Salt
- 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-(2-hydroxy-1-methylethyl)-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, monosodium salt, [3R-[3R*,5S*,6E,7(S*)]]-
- 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-[(1S)-2-hydroxy-1-methylethyl]-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, sodium salt (1:1), (3R,5S,6E)-
- M-23 Metabolite
- M-23 Metabolite, Sodium (E)-7-(3R,5S)-{4-(4-Fluorophenyl)-6-[(S)-(hydroxymethyl)ethyl]-2-isopropyl-5-methoxymethylpyrid-3-yl}-3,5-dihydroxyhept-6-enoate
- Sodium (E)-7-(3R,5S)-(4-(4-Fluorophenyl)-6-[(S)-(Hydroxymethyl)Ethyl]-2-Isopropyl-5-Methoxymethylpyrid-3-Yl)-3,5-Dihydroxyhept-6-Enoate

6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-[(1S)-2-hydroxy-1-methylethyl]-5-(methoxymethyl)-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, sodium salt (1:1), (3R,5S,6E)-
Ref: IN-DA002HSO
Undefined size | To inquire |

Hydroxy Cerivastatin-d3 Sodium Salt
Controlled ProductRef: TR-H900252
5mg | 3,150.00 € | ||
500µg | 459.00 € |

Hydroxy cerivastatin sodium salt
Ref: 3D-FH23938
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |