CAS 189063-54-5

4-(2H-Tetrazol-5-yl)benzenesulfonamide

Description:

4-(2H-Tetrazol-5-yl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group and a tetrazole ring. This compound features a benzene ring substituted with a sulfonamide group and a tetrazole moiety, which contributes to its unique chemical properties. The presence of the tetrazole ring imparts notable biological activity, often associated with pharmacological applications, including antimicrobial and anti-inflammatory effects. The sulfonamide group enhances its solubility in polar solvents, making it suitable for various chemical reactions and biological interactions. Additionally, the compound may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to extreme pH levels or strong oxidizing agents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, 4-(2H-Tetrazol-5-yl)benzenesulfonamide is a versatile compound with significant implications in both research and therapeutic contexts.

Formula: C₇H₇N₅O₂S

InChI: InChI=1S/C7H7N5O2S/c8-15(13,14)6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H2,8,13,14)(H,9,10,11,12)

InChI key: InChIKey=ANMFCTUVVZJPQL-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC=C(C=C1)C=2NN=NN2

Synonyms:

• Benzenesulfonamide, 4-(2H-tetrazol-5-yl)-
• 4-(2H-Tetrazol-5-yl)benzenesulfonamide
• Benzenesulfonamide, 4-(1H-tetrazol-5-yl)-

4-(2H-1,2,3,4-Tetrazol-5-yl)benzene-1-sulfonamide

CAS: 189063-54-5

Versatile small molecule scaffold

Formula: C₇H₇N₅O₂S

Purity: Min. 95%

Molecular weight: 225.23 g/mol

Ref: 3D-PHA06354