CAS 189089-83-6
:2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates both a methyl group and a phenylsulfonyl moiety. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic and polar functional groups. The presence of the sulfonyl group enhances its potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine and pyrrole rings. Additionally, it may exhibit specific interactions with biological targets, which could be explored in drug discovery contexts. Overall, 2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold for further chemical modifications and applications in various fields of research.
Formula:C14H12N2O2S
InChI:InChI=1/C14H12N2O2S/c1-11-10-12-6-5-9-15-14(12)16(11)19(17,18)13-7-3-2-4-8-13/h2-10H,1H3
SMILES:Cc1cc2cccnc2n1S(=O)(=O)c1ccccc1
Synonyms:- 1H-pyrrolo[2,3-b]pyridine, 2-methyl-1-(phenylsulfonyl)-
- 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
- 1-(benzenesulfonyl)-2-methylpyrrolo[2,3-b]pyridine
- 1-(phenylsulfonyl)-2-methyl-7-azaindole
- 189089-83-6
- 1-(Phenylsulphonyl)-2-Methyl-7-azaindole
- 1-(benzenesulfonyl)-2-Methyl-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C14H12N2O2SColor and Shape:SolidMolecular weight:272.3223
