CAS 1891-10-7
:2,4-dimethoxy-β-nitrostyrene
Description:
2,4-Dimethoxy-β-nitrostyrene is an organic compound characterized by its structure, which includes a styrene backbone substituted with two methoxy groups and a nitro group. The methoxy groups are located at the 2 and 4 positions of the aromatic ring, while the nitro group is attached to the β position relative to the styrene double bond. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. It exhibits properties such as moderate solubility in organic solvents and stability under standard conditions, although it may be sensitive to light and heat. The presence of both electron-donating (methoxy) and electron-withdrawing (nitro) groups influences its reactivity, making it a valuable compound in the study of electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-14-9-4-3-8(5-6-11(12)13)10(7-9)15-2/h3-7H,1-2H3/b6-5+
Synonyms:- Benzene, 2,4-dimethoxy-1-(2-nitroethenyl)-
- 2,4-Dimethoxy-1-(2-Nitroethenyl)Benzene
- 2,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,4-Dimethoxy-β-nitrostyrene
CAS:2,4-Dimethoxy-beta-nitrostyrene is a high quality, versatile building block for synthesis of complex compounds. It is an intermediate for the production of pharmaceuticals and other fine chemicals. 2,4-Dimethoxy-beta-nitrostyrene is used as a reagent in organic chemistry to produce complex compounds, such as esters and amides. This chemical has also been shown to be useful in research into the synthesis of new drugs.Formula:C10H11NO4Purity:Min. 95%Molecular weight:209.2 g/mol

