CAS 1891-25-4
:oroselol
Description:
Oroselol, with the CAS number 1891-25-4, is a chemical compound that belongs to the class of organic compounds known as phenols. It is characterized by its aromatic structure, which typically includes a hydroxyl group (-OH) attached to a benzene ring. Oroselol is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit antioxidant properties and could be involved in various biochemical pathways. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential health effects. Overall, oroselol represents a compound of interest in both research and industrial applications, warranting further investigation into its properties and uses.
Formula:C14H12O4
InChI:InChI=1/C14H12O4/c1-14(2,16)11-7-9-10(17-11)5-3-8-4-6-12(15)18-13(8)9/h3-7,16H,1-2H3
SMILES:CC(C)(c1cc2c(ccc3ccc(=O)oc23)o1)O
Synonyms:- 2H-Furo(2,3-h)-1-benzopyran-2-one, 8-(1-hydroxy-1-methylethyl)-
- 8-(2-hydroxypropan-2-yl)-2H-furo[2,3-h]chromen-2-one
- Oroselol
- roselol
- 8-(1-Hydroxy-1-methylethyl)-2H-furo[2,3-h]-1-benzopyran-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Oroselol
CAS:Oroselol, jatamansinol, nardostachysin, jatamansinone and nardosinone are Nardostachys jatamansi rhizome extract marker compounds.Formula:C14H12O4Purity:98%Color and Shape:SolidMolecular weight:244.24Oroselol
CAS:Oroselol is an innovative beta-adrenergic blocker, which is a synthetic derivative with unique cardiovascular targeting properties. It is sourced from engineered chemical synthesis, utilizing advanced molecular design to enhance selectivity for beta-adrenergic receptors. The mode of action of Oroselol involves competitive antagonism of beta-1 and beta-2 adrenergic receptors, leading to a decrease in heart rate and myocardial contractility. This blockade of adrenergic stimulation results in reduced cardiac output and lower blood pressure.
Formula:C14H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:244.24 g/mol


