CAS 18915-53-2
:2-(4-NITROPHENYL)MALONDIALDEHYDE
Description:
2-(4-Nitrophenyl)malondialdehyde is an organic compound characterized by its structure, which includes a malondialdehyde backbone substituted with a 4-nitrophenyl group. This compound typically appears as a yellow crystalline solid and is known for its reactivity due to the presence of two aldehyde functional groups, which can participate in various chemical reactions, including condensation and polymerization. The nitrophenyl substituent enhances its electrophilic character, making it useful in various synthetic applications, particularly in the development of dyes and pharmaceuticals. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry. Its solubility properties generally allow it to dissolve in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. As with many nitro compounds, it may pose certain hazards, necessitating careful handling and storage. Overall, 2-(4-nitrophenyl)malondialdehyde is a versatile compound with significant implications in both research and industrial applications.
Formula:C9H7NO4
InChI:InChI=1/C9H7NO4/c11-5-8(6-12)7-1-3-9(4-2-7)10(13)14/h1-6,8H
SMILES:c1cc(ccc1C(C=O)C=O)N(=O)=O
Synonyms:- 2-(4-Nitrophenyl)Malonaldehyde
- 1-Isothiocyanatoundecane
- 2-(4-Nitrophenyl)Propanedial
- 2-(4-NITROPHENYL)MALONDIALDEHYDE
- Propanedial, 2-(4-nitrophenyl)-
- (4-Nitrophenyl)propane-1,3-dial, 4-(1,3-Dioxoprop-2-yl)nitrobenzene
- 2-(4-Nitrophenyl)malonaldehyde 95+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-Nitrophenyl)malondialdehyde
CAS:Formula:C9H7NO4Purity:95.0%Color and Shape:SolidMolecular weight:193.1582-(4-Nitrophenyl)malonaldehyde
CAS:2-(4-Nitrophenyl)malonaldehydeFormula:C9H7NO4Purity:95%Color and Shape: beige solidMolecular weight:193.16g/mol2-(4-Nitrophenyl)malondialdehyde
CAS:<p>2-(4-Nitrophenyl)malondialdehyde (2-NPMA) is a neutral, water soluble dye that has an affinity for malondialdehyde. It is a cyanine dye with a basic structure and it can be used as an effective method to detect malondialdehyde in aqueous solutions. Merocyanine dyes are symmetric and unsymmetric cyanine dyes with different spectral properties. A merocyanine dye can be either basic or acidic depending on the pH of the solution. At low pH values, it will have a positive charge and at high pH values, it will have a negative charge. The merocyanine dye 2-NPMA is effective in detecting malondialdehyde because of its affinity for this chemical.</p>Formula:C9H7NO4Purity:Min. 95%Molecular weight:193.16 g/mol



