CAS 18918-31-5
:P-nitrophenyl A-L-rhamnopyranoside
Description:
P-nitrophenyl A-L-rhamnopyranoside is a chemical compound that serves as a glycoside, specifically a derivative of rhamnose, which is a naturally occurring sugar. It features a p-nitrophenyl group, which is a common chromogenic moiety used in biochemical assays, making this compound useful in various applications, particularly in enzymatic studies. The structure consists of a rhamnopyranoside unit linked to a p-nitrophenyl group through a glycosidic bond. This compound is typically used as a substrate for glycosidase enzymes, allowing researchers to study enzyme kinetics and mechanisms. It is characterized by its solubility in polar solvents, and its reactivity can be influenced by the presence of functional groups in the surrounding environment. Additionally, the p-nitrophenyl moiety can be hydrolyzed by specific enzymes, releasing p-nitrophenol, which can be quantitatively measured, providing a colorimetric indication of enzymatic activity. Overall, P-nitrophenyl A-L-rhamnopyranoside is a valuable tool in biochemical research and enzymology.
Formula:C12H15NO7
InChI:InChI=1/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9-,10+,11+,12-/m0/s1
Synonyms:- 4-Nitrophenylrhamnoside
- para-Nitrophenyl-alpha-L-rhamnoside
- alpha-L-Mannopyranoside, 4-nitrophenyl 6-deoxy-
- P-Nitrophenyl 6-Deoxy-Alpha-L-Mannopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
α-L-Mannopyranoside, 4-nitrophenyl 6-deoxy-
CAS:Formula:C12H15NO7Purity:%Color and Shape:SolidMolecular weight:285.25004-Nitrophenyl a-L-rhamnopyranoside
CAS:Formula:C12H15NO7Purity:≥ 98.0%Color and Shape:White to light yellow powderMolecular weight:285.254-Nitrophenyl α-L-rhamnopyranoside
CAS:<p>Chromogenic substrate for alpha-L-rhamnosidase</p>Formula:C12H15NO7Purity:Min. 99 Area-%Color and Shape:White Slightly Yellow PowderMolecular weight:285.25 g/mol4-Nitrophenyl α-L-Rhamnopyranoside
CAS:Controlled Product<p>Applications 4-Nitrophenyl α-L-Rhamnopyranoside is a chromogenic substrate for naringinase.<br>References Romero, C., et al., 1985. 149(2): 566-71. PMID: 3935009<br></p>Formula:C12H15NO7Color and Shape:NeatMolecular weight:171.581





