CAS 1892-31-5
:Thiopropionic acid
Description:
Thiopropionic acid, with the CAS number 1892-31-5, is a thiol-containing carboxylic acid characterized by the presence of a sulfur atom in its molecular structure. It has a molecular formula of C3H6O2S, indicating that it consists of three carbon atoms, six hydrogen atoms, two oxygen atoms, and one sulfur atom. This compound typically appears as a colorless to pale yellow liquid with a pungent odor, reminiscent of garlic or onion due to the presence of sulfur. Thiopropionic acid is known for its reactivity, particularly in forming thioesters and participating in various organic synthesis reactions. It is soluble in water and organic solvents, making it versatile for laboratory applications. Additionally, thiopropionic acid can act as a reducing agent and is used in the synthesis of various chemical compounds, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this substance, as it can be irritating to the skin and eyes.
Formula:C3H6OS
InChI:InChI=1S/C3H6OS/c1-2-3(4)5/h2H2,1H3,(H,4,5)
InChI key:InChIKey=KOODSCBKXPPKHE-UHFFFAOYSA-N
SMILES:C(CC)(=O)S
Synonyms:- NSC 74249
- Propanethioic acid
- Propionic acid, thio-
- Thiopropanoic acid
- propanethioic S-acid
- Thiopropionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

