
CAS 18921-68-1
:N-[4-[[(2,4-Diamino-6-quinazolinyl)methyl]amino]benzoyl]-L-glutamic acid
Description:
N-[4-[[(2,4-Diamino-6-quinazolinyl)methyl]amino]benzoyl]-L-glutamic acid, commonly referred to by its CAS number 18921-68-1, is a synthetic compound that exhibits properties characteristic of both amino acids and pharmaceutical agents. This substance features a quinazoline moiety, which is known for its biological activity, particularly in the context of antitumor and antimicrobial properties. The presence of the L-glutamic acid component suggests that it may interact with biological systems in a manner similar to natural amino acids, potentially influencing metabolic pathways. The compound's structure includes multiple functional groups, such as amine and carboxylic acid groups, which can participate in hydrogen bonding and ionic interactions, enhancing its solubility and reactivity in aqueous environments. Due to its complex structure, it may exhibit specific binding affinities to biological targets, making it of interest in medicinal chemistry and drug development. Overall, this compound represents a blend of structural features that may contribute to its pharmacological potential.
Formula:C21H22N6O5
InChI:InChI=1S/C21H22N6O5/c22-18-14-9-11(1-6-15(14)26-21(23)27-18)10-24-13-4-2-12(3-5-13)19(30)25-16(20(31)32)7-8-17(28)29/h1-6,9,16,24H,7-8,10H2,(H,25,30)(H,28,29)(H,31,32)(H4,22,23,26,27)/t16-/m0/s1
InChI key:InChIKey=IOLLERXPKZGYRA-INIZCTEOSA-N
SMILES:NC=1C2=C(C=CC(CNC3=CC=C(C(N[C@@H](CCC(O)=O)C(O)=O)=O)C=C3)=C2)N=C(N)N1
Synonyms:- L-Glutamic acid, N-[4-[[(2,4-diamino-6-quinazolinyl)methyl]amino]benzoyl]-
- N-[4-[[(2,4-Diamino-6-quinazolinyl)methyl]amino]benzoyl]-L-glutamic acid
- Deazaminopterin
- Glutamic acid, N-[p-[[(2,4-diamino-6-quinazolinyl)methyl]amino]benzoyl]-, L-
- Deazaaminopterin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Deazaminopterin
CAS:Deazaminopterin is a bioactive chemical.Formula:C21H22N6O5Color and Shape:SolidMolecular weight:438.44
