CymitQuimica logo

CAS 189274-36-0

:

(R)-(+)-(diphenylphosphino)-2'-isopropoxy-1,1'-binaphthyl

Description:
(R)-(+)-(diphenylphosphino)-2'-isopropoxy-1,1'-binaphthyl is a chiral ligand commonly used in asymmetric synthesis and catalysis. This compound features a binaphthyl backbone, which provides a rigid, planar structure that enhances its ability to coordinate with metal centers, making it valuable in transition metal-catalyzed reactions. The presence of the diphenylphosphino group contributes to its reactivity and selectivity in various catalytic processes, particularly in the formation of carbon-carbon bonds. The isopropoxy substituent enhances solubility and stability, allowing for better interaction with substrates. As a chiral ligand, it can induce chirality in reactions, leading to the formation of enantiomerically enriched products. Its stereochemistry is crucial for its function, as the (R)-enantiomer is often preferred for achieving high levels of enantioselectivity. Overall, this compound exemplifies the importance of ligand design in the field of asymmetric catalysis, where the choice of ligand can significantly influence reaction outcomes.
Formula:C33H33OP
InChI:InChI=1/C33H33OP/c1-6-15-25(4)32(33-30-21-14-13-16-27(30)22-23-31(33)34-24(2)3)26(5)35(28-17-9-7-10-18-28)29-19-11-8-12-20-29/h6-24H,5H2,1-4H3/b15-6-,32-25-
InChI key:RQYTYDOSGVUKHB-UHFFFAOYSA-N
SMILES:CC(C)OC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6
Synonyms:
  • (R)-(+)-(diphenylphosphino)-2'-isopropoxy-1,1'-binaphthyl
Found 4 products.