CAS 18928-91-1
:Cyclopentylmalonicaciddiethylester
Description:
Cyclopentylmalonic acid diethyl ester, with the CAS number 18928-91-1, is an organic compound characterized by its structure, which includes a cyclopentyl group attached to a malonic acid backbone that is esterified with two ethyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclopentyl group. The presence of the malonic acid moiety allows for potential reactivity in various chemical reactions, including esterification and condensation reactions. Cyclopentylmalonic acid diethyl ester can be utilized in organic synthesis, particularly in the preparation of more complex molecules, and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical and chemical properties, such as boiling point and density, can vary based on purity and environmental conditions, making it essential to consult specific data sheets for precise information in practical applications.
Formula:C12H20O4
InChI:InChI=1/C12H20O4/c1-3-15-11(13)10(12(14)16-4-2)9-7-5-6-8-9/h9-10H,3-8H2,1-2H3
SMILES:CCOC(=O)C(C1CCCC1)C(=O)OCC
Synonyms:- Cyclopentylmalonic acid diethyl ester
- Diethyl Cyclopentylmalonate
- Diethyl Cyclopentylpropanedioate
- Diethylcyclopentylpropanedioate
- 2-Cyclopentylmalonic acid diethyl ester
- diethyl 2-cyclopentylmalonate
- Cyclopentyl-Diethyl
- cyclopentylmalonicaciddiethylester95+%
- Nsc67358
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Diethyl Cyclopentylmalonate
CAS:Formula:C12H20O4Purity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:228.29Propanedioic acid, 2-cyclopentyl-, 1,3-diethyl ester
CAS:Formula:C12H20O4Purity:95%Color and Shape:LiquidMolecular weight:228.2848Diethyl Cyclopentylmalonate
CAS:Formula:C12H20O4Purity:95%Color and Shape:LiquidMolecular weight:228.288



