CAS 189280-13-5
:1-(6-amino-3,5-difluoropyridin-2-yl)-8-bromo-6-fluoro-7-[3-(methylamino)azetidin-1-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
Description:
The chemical substance known as 1-(6-amino-3,5-difluoropyridin-2-yl)-8-bromo-6-fluoro-7-[3-(methylamino)azetidin-1-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, with the CAS number 189280-13-5, is a complex organic compound characterized by its multi-functional groups and heterocyclic structure. It features a quinoline core, which is known for its biological activity, particularly in medicinal chemistry. The presence of fluorine atoms enhances its lipophilicity and may influence its pharmacokinetic properties. The amino and carboxylic acid groups contribute to its potential as a bioactive molecule, possibly affecting its solubility and interaction with biological targets. Additionally, the azetidine moiety introduces a cyclic amine structure, which can play a role in the compound's overall conformation and reactivity. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its diverse functional groups and potential for biological activity. However, specific biological activities and applications would require further investigation and empirical studies.
Formula:C19H15BrF3N5O3
InChI:InChI=1/C19H15BrF3N5O3/c1-25-7-4-27(5-7)15-10(21)2-8-14(13(15)20)28(6-9(16(8)29)19(30)31)18-12(23)3-11(22)17(24)26-18/h2-3,6-7,25H,4-5H2,1H3,(H2,24,26)(H,30,31)
SMILES:CNC1CN(C1)c1c(cc2c(c1Br)n(cc(c2=O)C(=O)O)c1c(cc(c(=N)[nH]1)F)F)F
Synonyms:- 1-(6-Amino-3,5-difluoro-2-pyridinyl)-8-bromo-6-fluoro-1,4-dihydro-7-[3-(methylamino)-1-azetidinyl]-4-oxo-3-quinolinecarboxylic acid
- 3-Quinolinecarboxylic acid, 1-(6-amino-3,5-difluoro-2-pyridinyl)-8-bromo-6-fluoro-1,4-dihydro-7-[3-(methylamino)-1-azetidinyl]-4-oxo-
- T66 Bn Evj Dvq Hf Je B- Bt6Nj Cf Ef Fz& I- At4Ntj Cm1 [Wln]
- 1-(6-Amino-3,5-difluoropyridin-2-yl)-8-bromo-6-fluoro-7-[3-(methylamino)azetidin-1-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
- WQ 2743
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(6-Amino-3,5-difluoropyridin-2-yl)-8-bromo-6-fluoro-7-[3-(methylamino)azetidin-1-yl]-4-oxoquinoline-3-carboxylic acid
CAS:<p>1-(6-Amino-3,5-difluoropyridin-2-yl)-8-bromo-6-fluoro-7-[3-(methylamino)azetidin-1-yl]-4-oxoquinoline-3-carboxylic acid is a synthetically derived quinoline derivative, which is produced through advanced organic chemistry methodologies involving halogenated pyridines and quinoline frameworks. The compound functions primarily as an antibacterial agent, targeting bacterial topoisomerase enzymes, thereby disrupting DNA replication and transcription processes.</p>Formula:C19H15BrF3N5O3Purity:Min. 95%Molecular weight:498.3 g/molWQ 2743
CAS:WQ 2743 is a potent agent of antimicrobial.Formula:C19H15BrF3N5O3Purity:98%Color and Shape:SolidMolecular weight:498.25

