CymitQuimica logo

CAS 189281-66-1

:

methyl 2,6-dichloro-5-fluoronicotinate

Description:
Methyl 2,6-dichloro-5-fluoronicotinate is an organic compound characterized by its pyridine ring structure, which is substituted with two chlorine atoms and one fluorine atom, along with a methoxy group. This compound is part of the nicotinic acid derivatives and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen substituents, such as chlorine and fluorine, often enhances the biological activity and lipophilicity of the molecule, making it a subject of interest in drug design. Methyl 2,6-dichloro-5-fluoronicotinate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties include reactivity towards nucleophiles and electrophiles, which can be exploited in various synthetic pathways. Additionally, the compound's structure suggests potential interactions with biological targets, which could be investigated for therapeutic effects. Safety data and handling precautions should be considered due to the presence of halogens, which can pose health risks.
Formula:C7H4Cl2FNO2
InChI:InChI=1/C7H4Cl2FNO2/c1-13-7(12)3-2-4(10)6(9)11-5(3)8/h2H,1H3
InChI key:WADLLLSMEPLCNO-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(c(Cl)nc1Cl)F
Synonyms:
  • Methyl 2,6-Dichloro-5-Fluoropyridine-3-Carboxylate
Found 4 products.