CAS 189283-51-0
:3,4-DIFLUORO-2-HYDROXYBENZOIC ACID
Description:
3,4-Difluoro-2-hydroxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a hydroxyl group on a benzene ring. The fluorine substituents are located at the 3 and 4 positions relative to the carboxylic acid group, which is situated at the 2 position. This compound exhibits both acidic and phenolic properties due to the carboxylic acid and hydroxyl functional groups, respectively. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique biological activities due to its structural features, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H4F2O3
InChI:InChI=1S/C7H4F2O3/c8-4-2-1-3(7(11)12)6(10)5(4)9/h1-2,10H,(H,11,12)
InChI key:GWOOBUWKTOCYKY-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1C(=O)O)O)F)F
Synonyms:- 3,4-Difluorosalicylic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3,4-Difluorosalicylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4F2O3Purity:98%Color and Shape:White to cream, Crystals or crystalline powderMolecular weight:174.103,4-Difluoro-2-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:98%Color and Shape:SolidMolecular weight:174.10173,4-Difluoro-2-hydroxybenzoic acid
CAS:3,4-Difluoro-2-hydroxybenzoic acidFormula:C7H4F2O3Purity:>97%Color and Shape:Solid-PowderMolecular weight:174.101663,4-Difluoro-2-hydroxybenzoic acid
CAS:3,4-Difluoro-2-hydroxybenzoic acidFormula:C7H4F2O3Purity:97%Molecular weight:174.13,4-Difluoro-2-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:97%Color and Shape:SolidMolecular weight:174.1033,4-Difluorosalicylic acid
CAS:3,4-Difluorosalicylic acid is a fluorinated salicylic acid derivative that has been shown to have anticancer activity. It has been shown to induce apoptosis in cancer cells by inhibiting thiobarbituric acid reactive substances (TBARS) and the formation of reactive oxygen species (ROS). 3,4-Difluorosalicylic acid also inhibits the growth of cancer cell lines in vitro. 3,4-Difluorosalicylic acid is synthesized from salicylic acid by a high yield process using fluorous chemistry and a flow cytometer.Formula:C7H4F2O3Purity:Min. 95%Molecular weight:174.1 g/mol





