CAS 189307-15-1
:Neomogroside
Description:
Neomogroside is a natural sweetener derived from the fruit of the Siraitia grosvenorii plant, commonly known as monk fruit. It is classified as a mogroside, which are glycosides that contribute to the fruit's intense sweetness, often reported to be significantly sweeter than sucrose. Neomogroside is characterized by its low-calorie content, making it a popular alternative to traditional sugars in food and beverage applications. It is known for its stability under heat and acidic conditions, which allows it to be used in various cooking and baking processes without losing its sweetness. Additionally, neomogroside has been studied for potential health benefits, including antioxidant properties and possible anti-inflammatory effects. As a non-nutritive sweetener, it does not raise blood sugar levels, making it suitable for individuals with diabetes or those seeking to reduce caloric intake. Its safety has been evaluated, and it is generally recognized as safe (GRAS) by food safety authorities, contributing to its growing popularity in the health-conscious market.
Formula:C66H112O34
InChI:InChI=1S/C66H112O34/c1-24(9-13-37(63(4,5)88)98-61-55(100-59-53(87)47(81)41(75)31(21-70)94-59)49(83)43(77)33(96-61)23-90-57-51(85)45(79)39(73)29(19-68)92-57)25-15-16-64(6)34-12-10-26-27(66(34,8)35(71)17-65(25,64)7)11-14-36(62(26,2)3)97-60-54(99-58-52(86)46(80)40(74)30(20-69)93-58)48(82)42(76)32(95-60)22-89-56-50(84)44(78)38(72)28(18-67)91-56/h10,24-25,27-61,67-88H,9,11-23H2,1-8H3/t24-,25-,27-,28-,29-,30-,31-,32-,33-,34+,35-,36+,37-,38-,39-,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,54-,55-,56-,57-,58+,59+,60+,61+,64+,65-,66+/m1/s1
InChI key:InChIKey=LTDANPHZAHSOBN-ISABJOOBSA-N
SMILES:C[C@]12[C@]([C@@]3(C)[C@](C)(C[C@H]1O)[C@@]([C@@H](CC[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)O4)C(C)(C)O)C)(CC3)[H])(CC=C7[C@]2(CC[C@H](O[C@H]8[C@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]%10O[C@H](CO)[C@@H](O)[C@H](O)[C@H]%10O)O8)C7(C)C)[H])[H]
Synonyms:- (3β,9β,10α,11α,24R)-11,25-Dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→2)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→6)]-β-<smallcap>D</span>-glucopyranoside
- Mogroside VI
- Neomogroside
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (3β,9β,10α,11α,24R)-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-<smallcap>D</smallcap>-glucopyranosyl-(1→2)-O-[β-<smallcap>D</span>-glucopyranosyl-(1→6)]-
- β-D-Glucopyranoside, (3β,9β,10α,11α,24R)-11,25-dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→6)]-
- (3β,9β,10α,11α,24R)-11,25-Dihydroxy-9-methyl-19-norlanost-5-ene-3,24-diyl bis[O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→6)]-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Mogroside VI
CAS:Lo Han Kuo extract: no-calorie sweetener, prevents cavities, suitable for diabetics, contains mogrosides with antimicrobial and insulin-boosting properties.Formula:C66H112O34Purity:98%Color and Shape:SolidMolecular weight:1449.588Mogroside VI
CAS:<p>Mogroside VI is a triterpenoid glycoside, which is a natural sweetener primarily derived from the fruit of Siraitia grosvenorii, commonly known as monk fruit. This compound is sourced from the Mongolian region of southern China, where the fruit is traditionally used for its sweet taste and therapeutic properties. The mode of action of Mogroside VI involves its high sweetness intensity due to its structure, which interacts with taste receptors on the human tongue. It is also thought to exhibit potential antioxidant activities by scavenging free radicals, although the exact molecular pathways remain under investigation.The applications of Mogroside VI are diverse, primarily focused on its use as a non-caloric sweetener in various food and beverage products, catering to dietary preferences requiring low-sugar or sugar-free formulations. Beyond its sweetening capabilities, ongoing research explores its potential health benefits, including anti-inflammatory and anticancer properties, although more rigorous scientific investigations are required to substantiate these effects. Therefore, Mogroside VI represents a multifaceted compound of interest within nutritional and medical research, warranting further exploration of its biochemical properties and therapeutic potential.</p>Formula:C66H112O34Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,449.58 g/mol


