CAS 189308-10-9

Xanthohumol B

Description:

Xanthohumol B is a prenylated flavonoid primarily derived from hops (Humulus lupulus), known for its potential health benefits and bioactive properties. It is characterized by its complex structure, which includes multiple aromatic rings and a prenyl group, contributing to its unique chemical behavior. This compound exhibits antioxidant, anti-inflammatory, and antimicrobial activities, making it of interest in both food science and pharmacology. Xanthohumol B has been studied for its potential role in cancer prevention and cardiovascular health, as it may influence various biological pathways. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in dietary supplements and functional foods. Additionally, research into its pharmacokinetics and bioavailability is ongoing, as these factors significantly impact its efficacy in therapeutic contexts. Overall, Xanthohumol B represents a promising area of study within natural product chemistry and nutraceutical development.

Formula: C₂₁H₂₂O₆

InChI: InChI=1S/C21H22O6/c1-21(2)18(24)10-14-16(27-21)11-17(26-3)19(20(14)25)15(23)9-6-12-4-7-13(22)8-5-12/h4-9,11,18,22,24-25H,10H2,1-3H3/b9-6+

InChI key: InChIKey=GUQGMEWOCKDLDE-RMKNXTFCSA-N

SMILES: OC1=C2C(=CC(OC)=C1C(/C=C/C3=CC=C(O)C=C3)=O)OC(C)(C)C(O)C2

Synonyms:

• 2-Propen-1-one, 1-(3,4-dihydro-3,5-dihydroxy-7-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-3-(4-hydroxyphenyl)-, (E)-
• Xanthohumol B
• Dehydrocycloxanthohumol hydrate
• 2-Propen-1-one, 1-(3,4-dihydro-3,5-dihydroxy-7-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-3-(4-hydroxyphenyl)-, (2E)-
• (2E)-1-(3,4-Dihydro-3,5-dihydroxy-7-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-3-(4-hydroxyphenyl)-2-propen-1-one

Xanthohumol B

CAS: 189308-10-9

Formula: C₂₁H₂₂O₆

Purity: 95%~99%

Molecular weight: 370.401

Ref: BP-BP4024

Xanthohumol B

CAS: 189308-10-9

Xanthohumol B is a prenylated flavonoid, which is derived from the hops plant (Humulus lupulus). As a secondary metabolite found in hops, this compound is part of a subclass of flavonoids known for their bioactive properties. Its mode of action primarily involves the modulation of various biochemical pathways, including antioxidant, anti-inflammatory, and anti-cancer mechanisms. It acts by scavenging reactive oxygen species, inhibiting certain enzymes, and interacting with molecular targets involved in cellular signaling and apoptosis.

Formula: C₂₁H₂₂O₆

Purity: Min. 95%

Molecular weight: 370.40 g/mol

Ref: 3D-PHA30810