CAS 189333-49-1

3-Benzyl-3,9-Diaza-Spiro[5.5]Undecane

Description:

3-Benzyl-3,9-Diaza-Spiro[5.5]Undecane is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with two nitrogen atoms incorporated into the ring system. This compound belongs to a class of compounds known as spiro compounds, where two rings share a single atom. The presence of the benzyl group contributes to its hydrophobic characteristics and may influence its biological activity. The diaza component indicates that there are two nitrogen atoms in the structure, which can participate in various chemical interactions, including hydrogen bonding. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its unique configuration may impart specific stereochemical properties that could be relevant in drug design. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, making it a subject of interest in research and development.

Formula: C₁₆H₂₄N₂

InChI: InChI=1/C16H24N2/c1-2-4-15(5-3-1)14-18-12-8-16(9-13-18)6-10-17-11-7-16/h1-5,17H,6-14H2

SMILES: c1ccc(cc1)CN1CCC2(CCNCC2)CC1

Synonyms:

• 3,9-Diazaspiro[5.5]Undecane, 3-(Phenylmethyl)-
• 3-Benzyl-3,9-diazaspiro[5.5]undecan

3,9-Diazaspiro[5.5]undecane, 3-(phenylmethyl)-

CAS: 189333-49-1

Formula: C₁₆H₂₄N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 244.3752

Ref: IN-DA002IB3

3-Benzyl-3,9-diazaspiro[5.5]undecane

CAS: 189333-49-1

3-Benzyl-3,9-diazaspiro[5.5]undecane

Purity: 95%

Molecular weight: 244.38g/mol

Ref: 54-OR306396

3-Benzyl-3,9-diazaspiro[5.5]undecane

CAS: 189333-49-1

Formula: C₁₆H₂₄N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 244.382

Ref: 10-F075935