CAS 189367-54-2
:9,9-Dihexyl-2,7-dibromofluorene
Description:
9,9-Dihexyl-2,7-dibromofluorene is an organic compound characterized by its unique structure, which includes a fluorene backbone substituted with two bromine atoms and two hexyl groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its stability and solubility in organic solvents. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions for the synthesis of more complex organic molecules. The hexyl substituents provide hydrophobic characteristics, which can influence its solubility and interaction with other materials, particularly in polymeric applications. Additionally, compounds like 9,9-Dihexyl-2,7-dibromofluorene are often studied for their potential applications in organic electronics, such as in light-emitting diodes (LEDs) and photovoltaic devices, due to their favorable electronic properties. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the importance of molecular design in developing functional materials.
Formula:C25H32Br2
InChI:InChI=1/C25H32Br2/c1-3-5-7-9-15-25(16-10-8-6-4-2)23-17-19(26)11-13-21(23)22-14-12-20(27)18-24(22)25/h11-14,17-18H,3-10,15-16H2,1-2H3
SMILES:CCCCCCC1(CCCCCC)c2cc(ccc2c2ccc(cc12)Br)Br
Synonyms:- 2,7-dibromo-9,9-dihexyl-9H-fluorene
- K0087
- 2,7-Dibromo-9,9-dihexylfluorene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,7-Dibromo-9,9-dihexylfluorene
CAS:Formula:C25H32Br2Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:492.349,9-Di-n-hexyl-2,7-dibromofluorene, 98%
CAS:It finds its application as an intermediate for polymeric light-emitting diodes and as an OLED material because of their pure blue emission and efficient electroluminescence coupled with a high charge-carrier mobility and good process ability. This Thermo Scientific Chemicals brand product was origFormula:C25H32Br2Purity:98%Molecular weight:492.349H-Fluorene, 2,7-dibromo-9,9-dihexyl-
CAS:Formula:C25H32Br2Purity:97%Color and Shape:SolidMolecular weight:492.32969,9-Dihexyl-2,7-dibromofluorene
CAS:9,9-Dihexyl-2,7-dibromofluorenePurity:97%Molecular weight:492.33g/mol2,7-Dibromo-9,9-dihexyl-9H-fluorene
CAS:Purity:97%Color and Shape:SolidMolecular weight:492.33898925781252,7-Dibromo-9,9-dihexylfluorene
CAS:2,7-Dibromo-9,9-dihexylfluorene is a vinyl monomer that can be used for the synthesis of polymers with light emitting properties. It has been shown to be an efficient cross-coupling agent for the synthesis of organic molecules. The monomer also emits light when excited by ultraviolet radiation.Purity:Min. 95%





