CAS 1895-26-7
:Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl) hydrogen phosphate
Description:
Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl) hydrogen phosphate, with CAS number 1895-26-7, is a complex organophosphate compound characterized by its long-chain fluorinated alkyl groups. This structure imparts unique properties, such as high hydrophobicity and lipophobicity, making it useful in various applications, including surfactants, emulsifiers, and potential uses in coatings and materials science. The presence of multiple fluorinated carbon chains enhances its thermal and chemical stability, while the phosphate group contributes to its reactivity and potential for forming hydrogen bonds. This compound is typically synthesized through specific chemical reactions involving fluorinated alcohols and phosphoric acid derivatives. Due to its fluorinated nature, it may exhibit low surface tension and high resistance to degradation, which can raise environmental concerns regarding persistence and bioaccumulation. Safety data sheets should be consulted for handling and disposal guidelines, as organophosphates can pose health risks if not managed properly.
Formula:C24H9F42O4P
InChI:InChI=1S/C24H9F42O4P/c25-5(26,7(29,30)9(33,34)11(37,38)13(41,42)15(45,46)17(49,50)19(53,54)21(57,58)23(61,62)63)1-3-69-71(67,68)70-4-2-6(27,28)8(31,32)10(35,36)12(39,40)14(43,44)16(47,48)18(51,52)20(55,56)22(59,60)24(64,65)66/h1-4H2,(H,67,68)
InChI key:InChIKey=FHENBBPEACDTCF-UHFFFAOYSA-N
SMILES:C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(CCOP(OCCC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-, hydrogen phosphate
- Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl) hydrogen phosphate
- Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl) hydrogen phosphate
- DTXSID30172360
- 1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-, 1,1′-(hydrogen phosphate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Bis[2-(perfluorodecyl)ethyl] Phosphate
CAS:Applications Fluoro phosphates useful as surfactants, surface treating agents, leveling agents.
Formula:C24H9F42O4PColor and Shape:NeatMolecular weight:1190.23


