CymitQuimica logo

CAS 18950-64-6

:

Benzo[g]pteridine-2,4(1H,3H)-dione, 1,7,8-trimethyl-

Description:
Benzo[g]pteridine-2,4(1H,3H)-dione, 1,7,8-trimethyl- is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pteridine ring system. This compound features three methyl groups at the 1, 7, and 8 positions, contributing to its unique chemical properties. It is known for its potential biological activity, including roles in various biochemical pathways. The presence of the dione functional groups indicates that it can participate in redox reactions, making it a candidate for studies in medicinal chemistry and pharmacology. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its applications in research. Additionally, its molecular structure may influence its interaction with biological targets, making it of interest in the development of therapeutic agents. Overall, Benzo[g]pteridine-2,4(1H,3H)-dione, 1,7,8-trimethyl- is a compound with significant implications in both synthetic and medicinal chemistry.
Formula:C13H12N4O2
InChI:InChI=1S/C13H12N4O2/c1-6-4-8-9(5-7(6)2)15-11-10(14-8)12(18)16-13(19)17(11)3/h4-5H,1-3H3,(H,16,18,19)
InChI key:JMJYJUDFYYXGBX-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1C)N=C3C(=N2)C(=O)NC(=O)N3C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.