CAS 18951-85-4

(R)-(+)-citronellic acid

Description:

(R)-(+)-citronellic acid is a chiral organic compound classified as a fatty acid. It is derived from citronellol, a natural monoterpenoid alcohol found in various essential oils. This compound features a carboxylic acid functional group, which imparts acidic properties, and a long hydrocarbon chain, contributing to its hydrophobic characteristics. The presence of a chiral center in its structure gives rise to its enantiomeric form, with the (R)-configuration being the naturally occurring form. (R)-(+)-citronellic acid is known for its pleasant citrus aroma and is often utilized in the fragrance and flavor industries. Additionally, it exhibits potential biological activities, including antimicrobial and anti-inflammatory properties. Its solubility is generally higher in organic solvents than in water, which is typical for fatty acids. The compound's stability and reactivity can be influenced by factors such as temperature and pH, making it relevant in various chemical synthesis and formulation processes. Overall, (R)-(+)-citronellic acid is significant in both natural product chemistry and industrial applications.

Formula: C₁₀H₁₈O₂

InChI: InChI=1/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m1/s1

SMILES: CC(=CCC[C@@H](C)CC(=O)O)C

Synonyms:

• (3R)-3,7-dimethyloct-6-enoic acid

6-Octenoic acid, 3,7-dimethyl-, (3R)-

CAS: 18951-85-4

Formula: C₁₀H₁₈O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.2487

Ref: IN-DA002DQE

(R)-(+)-Citronellic acid

CAS: 18951-85-4

Formula: (CH₃)₂CCHCH₂CH₂CH(CH₃)CH₂CO₂H

Molecular weight: 170.25

Ref: 7W-GK3064

(R)-(+)-Citronellic acid

CAS: 18951-85-4

(R)-(+)-Citronellic acid

Purity: 98%

Color and Shape: Colourless Liquid

Molecular weight: 170.25g/mol

Ref: 54-OR55109

(R)-(+)-Citronellic Acid

Controlled Product

CAS: 18951-85-4

Applications (R)-(+)-Citronellic Acid is an oxidized derivative of Citronellal (C525025), a monoterpene compound that is formed by the metabolism of plants.
References Brito, R.G., et al.: J. Nat. Med., 66, 637 (2012);

Formula: C₁₀H₁₈O₂

Color and Shape: Neat

Molecular weight: 170.25

Ref: TR-C525040

(R)-3,7-DIMETHYLOCT-6-ENOIC ACID

CAS: 18951-85-4

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 170.2519989

Ref: 10-F830031